About N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide
N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide (PubChem CID 139087883) has the molecular formula C19H13ClF2N2O2
and a molecular weight of 374.77 g/mol. Its IUPAC name is N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide |
| PubChem CID | 139087883 |
| Molecular Formula | C19H13ClF2N2O2 |
| Molecular Weight | 374.77 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc(OCc2ccc(Cl)nc2)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H13ClF2N2O2/c20-17-9-4-12(10-23-17)11-26-14-7-5-13(6-8-14)24-19(25)18-15(21)2-1-3-16(18)22/h1-10H,11H2,(H,24,25) |
| InChIKey | FWCWRHBTMYKJAC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide?
The IUPAC name of N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide (CID 139087883) is N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide is O=C(Nc1ccc(OCc2ccc(Cl)nc2)cc1)c1c(F)cccc1F.
What is the InChIKey of N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide?
The InChIKey is FWCWRHBTMYKJAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClF2N2O2/c20-17-9-4-12(10-23-17)11-26-14-7-5-13(6-8-14)24-19(25)18-15(21)2-1-3-16(18)22/h1-10H,11H2,(H,24,25).
What are the key properties of N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide?
N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide has a molecular weight of 374.77 g/mol, XLogP of 4.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(6-chloro-3-pyridinyl)methoxy]phenyl]-2,6-difluorobenzamide is sourced from PubChem (CID 139087883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).