C17H14BrNO2 — CID 139088080
(2E)-2-[(2-bromo-3-pyridinyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one (PubChem CID 139088080) has the molecular formula C17H14BrNO2 and a molecular weight of 344.21 g/mol. Its IUPAC name is (2E)-2-[(2-bromo-3-pyridinyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[(2-bromo-3-pyridinyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 139088080 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | (2E)-2-[(2-bromo-3-pyridinyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one |
| SMILES | COc1ccc2c(c1)CC/C(=C\c1cccnc1Br)C2=O |
| InChI | InChI=1S/C17H14BrNO2/c1-21-14-6-7-15-11(10-14)4-5-12(16(15)20)9-13-3-2-8-19-17(13)18/h2-3,6-10H,4-5H2,1H3/b12-9+ |
| InChIKey | KXTZARTYFRXBLN-FMIVXFBMSA-N |
| XLogP | 4.07 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|