About 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine
5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine (PubChem CID 139088090) has the molecular formula C12H12ClN3O4S
and a molecular weight of 329.77 g/mol. Its IUPAC name is 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine.
Molecular Properties
| Compound Name | 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine |
| PubChem CID | 139088090 |
| Molecular Formula | C12H12ClN3O4S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine |
| SMILES | Cc1nc(C)c(Cl)c(N)[nH+]1.O=C([O-])c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C6H8ClN3.C6H4O4S/c1-3-5(7)6(8)10-4(2)9-3;7-5(8)3-1-2-4(11-3)6(9)10/h1-2H3,(H2,8,9,10);1-2H,(H,7,8)(H,9,10) |
| InChIKey | ZJMIAHUMBWANDX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine?
The IUPAC name of 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine (CID 139088090) is 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine.
What is the SMILES notation for 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine?
The canonical SMILES for 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine is Cc1nc(C)c(Cl)c(N)[nH+]1.O=C([O-])c1ccc(C(=O)O)s1.
What is the InChIKey of 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine?
The InChIKey is ZJMIAHUMBWANDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN3.C6H4O4S/c1-3-5(7)6(8)10-4(2)9-3;7-5(8)3-1-2-4(11-3)6(9)10/h1-2H3,(H2,8,9,10);1-2H,(H,7,8)(H,9,10).
What are the key properties of 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine?
5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine has a molecular weight of 329.77 g/mol, XLogP of 0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-carboxythiophene-2-carboxylate;5-chloro-2,6-dimethylpyrimidin-3-ium-4-amine is sourced from PubChem (CID 139088090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).