C16H20O14 — CID 139088441
dimethyl (2S,3R)-3-hydroxy-5-oxooxolane-2,3-dicarboxylate (PubChem CID 139088441) has the molecular formula C16H20O14 and a molecular weight of 436.32 g/mol. Its IUPAC name is dimethyl (2S,3R)-3-hydroxy-5-oxooxolane-2,3-dicarboxylate.
| Compound Name | dimethyl (2S,3R)-3-hydroxy-5-oxooxolane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139088441 |
| Molecular Formula | C16H20O14 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | dimethyl (2S,3R)-3-hydroxy-5-oxooxolane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1OC(=O)C[C@]1(O)C(=O)OC.COC(=O)[C@H]1OC(=O)C[C@]1(O)C(=O)OC |
| InChI | InChI=1S/2C8H10O7/c2*1-13-6(10)5-8(12,7(11)14-2)3-4(9)15-5/h2*5,12H,3H2,1-2H3/t2*5-,8-/m11/s1 |
| InChIKey | YTIOBKNDWOCYIT-FURWCLEOSA-N |
| XLogP | -3.24 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|