C13H24BNO2 — CID 139088815
carboxy-[[(3S,5R)-3,5-dimethyl-1-adamantyl]azaniumyl]boranuide (PubChem CID 139088815) has the molecular formula C13H24BNO2 and a molecular weight of 237.15 g/mol. Its IUPAC name is carboxy-[[(3S,5R)-3,5-dimethyl-1-adamantyl]azaniumyl]boranuide.
| Compound Name | carboxy-[[(3S,5R)-3,5-dimethyl-1-adamantyl]azaniumyl]boranuide |
|---|---|
| PubChem CID | 139088815 |
| Molecular Formula | C13H24BNO2 |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | carboxy-[[(3S,5R)-3,5-dimethyl-1-adamantyl]azaniumyl]boranuide |
| SMILES | C[C@]12CC3CC([NH2+][BH2-]C(=O)O)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C13H24BNO2/c1-11-3-9-4-12(2,6-11)8-13(5-9,7-11)15-14-10(16)17/h9H,3-8,14-15H2,1-2H3,(H,16,17)/t9?,11-,12+,13? |
| InChIKey | QSDVYSZMWYVMHS-QGVZIFMBSA-N |
| XLogP | 1.06 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|