C23H26F3NO2 — CID 139089491
(2S)-1-[(2S,4S,6S)-2,4-dimethyl-6-phenylpiperidin-1-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one (PubChem CID 139089491) has the molecular formula C23H26F3NO2 and a molecular weight of 405.46 g/mol. Its IUPAC name is (2S)-1-[(2S,4S,6S)-2,4-dimethyl-6-phenylpiperidin-1-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one.
| Compound Name | (2S)-1-[(2S,4S,6S)-2,4-dimethyl-6-phenylpiperidin-1-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 139089491 |
| Molecular Formula | C23H26F3NO2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (2S)-1-[(2S,4S,6S)-2,4-dimethyl-6-phenylpiperidin-1-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one |
| SMILES | CO[C@](C(=O)N1[C@@H](C)C[C@H](C)C[C@H]1c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H26F3NO2/c1-16-14-17(2)27(20(15-16)18-10-6-4-7-11-18)21(28)22(29-3,23(24,25)26)19-12-8-5-9-13-19/h4-13,16-17,20H,14-15H2,1-3H3/t16-,17-,20-,22-/m0/s1 |
| InChIKey | ZBYUREYSNKIYLG-TZLLFPAYSA-N |
| XLogP | 5.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |