C10H18O3 — CID 139089673
(1R,2S,5S,7R)-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octane-2,7-diol (PubChem CID 139089673) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1R,2S,5S,7R)-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octane-2,7-diol.
| Compound Name | (1R,2S,5S,7R)-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octane-2,7-diol |
|---|---|
| PubChem CID | 139089673 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1R,2S,5S,7R)-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octane-2,7-diol |
| SMILES | C[C@@]12CC[C@H](O)[C@@](C)(O1)[C@](C)(O)C2 |
| InChI | InChI=1S/C10H18O3/c1-8-5-4-7(11)10(3,13-8)9(2,12)6-8/h7,11-12H,4-6H2,1-3H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | CFXUVAZMKAAHST-AXTSPUMRSA-N |
| XLogP | 0.83 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |