C17H18N2 — CID 139089766
2-benzyl-2-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]propanedinitrile (PubChem CID 139089766) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-benzyl-2-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]propanedinitrile.
| Compound Name | 2-benzyl-2-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]propanedinitrile |
|---|---|
| PubChem CID | 139089766 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-benzyl-2-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]propanedinitrile |
| SMILES | N#CC(C#N)(Cc1ccccc1)[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H18N2/c18-11-17(12-19,10-13-4-2-1-3-5-13)16-9-14-6-7-15(16)8-14/h1-5,14-16H,6-10H2/t14-,15+,16+/m1/s1 |
| InChIKey | FTCMBFWSBUHZMQ-PMPSAXMXSA-N |
| XLogP | 3.70 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |