C54H40B2N2O2 — CID 139089996
2,2,7-triphenyl-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene (PubChem CID 139089996) has the molecular formula C54H40B2N2O2 and a molecular weight of 770.55 g/mol. Its IUPAC name is 2,2,7-triphenyl-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene.
| Compound Name | 2,2,7-triphenyl-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene |
|---|---|
| PubChem CID | 139089996 |
| Molecular Formula | C54H40B2N2O2 |
| Molecular Weight | 770.55 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | 2,2,7-triphenyl-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene |
| SMILES | c1ccc(-c2ccc3c4c2ccc[n+]4[B-](c2ccccc2)(c2ccccc2)O3)cc1.c1ccc(-c2ccc3c4c2ccc[n+]4[B-](c2ccccc2)(c2ccccc2)O3)cc1 |
| InChI | InChI=1S/2C27H20BNO/c2*1-4-11-21(12-5-1)24-18-19-26-27-25(24)17-10-20-29(27)28(30-26,22-13-6-2-7-14-22)23-15-8-3-9-16-23/h2*1-20H |
| InChIKey | LBFHIWAAIUGPDE-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.55 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|