About bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate
bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate (PubChem CID 139090020) has the molecular formula C26H54O5
and a molecular weight of 446.71 g/mol. Its IUPAC name is bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate.
Molecular Properties
| Compound Name | bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate |
| PubChem CID | 139090020 |
| Molecular Formula | C26H54O5 |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 446.40 |
| IUPAC Name | bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate |
| SMILES | CC[C@]1(OC)CC[C@](O)(C(C)(C)C)CC1.CC[C@]1(OC)CC[C@](O)(C(C)(C)C)CC1.O |
| InChI | InChI=1S/2C13H26O2.H2O/c2*1-6-12(15-5)7-9-13(14,10-8-12)11(2,3)4;/h2*14H,6-10H2,1-5H3;1H2/t2*12-,13+; |
| InChIKey | VJHIANOOOWBHBM-OYDVTBOOSA-N |
| XLogP | 5.44 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate?
The IUPAC name of bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate (CID 139090020) is bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate.
What is the SMILES notation for bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate?
The canonical SMILES for bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate is CC[C@]1(OC)CC[C@](O)(C(C)(C)C)CC1.CC[C@]1(OC)CC[C@](O)(C(C)(C)C)CC1.O.
What is the InChIKey of bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate?
The InChIKey is VJHIANOOOWBHBM-OYDVTBOOSA-N. The full InChI is InChI=1S/2C13H26O2.H2O/c2*1-6-12(15-5)7-9-13(14,10-8-12)11(2,3)4;/h2*14H,6-10H2,1-5H3;1H2/t2*12-,13+;.
What are the key properties of bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate?
bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate has a molecular weight of 446.71 g/mol, XLogP of 5.44, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-tert-butyl-4-ethyl-4-methoxycyclohexan-1-ol);hydrate is sourced from PubChem (CID 139090020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).