C14H10N4 — CID 139090210
(1R,4S)-7-propan-2-ylidenebicyclo[2.2.1]hept-5-ene-2,2,3,3-tetracarbonitrile (PubChem CID 139090210) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is (1R,4S)-7-propan-2-ylidenebicyclo[2.2.1]hept-5-ene-2,2,3,3-tetracarbonitrile.
| Compound Name | (1R,4S)-7-propan-2-ylidenebicyclo[2.2.1]hept-5-ene-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 139090210 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (1R,4S)-7-propan-2-ylidenebicyclo[2.2.1]hept-5-ene-2,2,3,3-tetracarbonitrile |
| SMILES | CC(C)=C1[C@H]2C=C[C@@H]1C(C#N)(C#N)C2(C#N)C#N |
| InChI | InChI=1S/C14H10N4/c1-9(2)12-10-3-4-11(12)14(7-17,8-18)13(10,5-15)6-16/h3-4,10-11H,1-2H3/t10-,11+ |
| InChIKey | FXHGIICGVQDGJH-PHIMTYICSA-N |
| XLogP | 2.21 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|