C29H28Cl2O3 — CID 139090336
(1S,2'E,6R,6'E,8R)-2',6'-bis[(4-chlorophenyl)methylidene]-6-methylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,1'-cyclohexane]-7-one (PubChem CID 139090336) has the molecular formula C29H28Cl2O3 and a molecular weight of 495.45 g/mol. Its IUPAC name is (1S,2'E,6R,6'E,8R)-2',6'-bis[(4-chlorophenyl)methylidene]-6-methylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,1'-cyclohexane]-7-one.
| Compound Name | (1S,2'E,6R,6'E,8R)-2',6'-bis[(4-chlorophenyl)methylidene]-6-methylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 139090336 |
| Molecular Formula | C29H28Cl2O3 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | (1S,2'E,6R,6'E,8R)-2',6'-bis[(4-chlorophenyl)methylidene]-6-methylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,1'-cyclohexane]-7-one |
| SMILES | C[C@]12CCCC[C@@]13O[C@@H](C2=O)C1(O3)/C(=C/c2ccc(Cl)cc2)CCC/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H28Cl2O3/c1-27-15-2-3-16-28(27)33-26(25(27)32)29(34-28)21(17-19-7-11-23(30)12-8-19)5-4-6-22(29)18-20-9-13-24(31)14-10-20/h7-14,17-18,26H,2-6,15-16H2,1H3/b21-17+,22-18+/t26-,27+,28-/m0/s1 |
| InChIKey | XBQXOEMXMVHVST-YRFBPBRNSA-N |
| XLogP | 7.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |