C19H21NO7S — CID 139090340
methyl (4aS,5S,8aR)-5-methoxy-1-(4-methylphenyl)sulfonyl-2,7-dioxo-5,6,8,8a-tetrahydroquinoline-4a-carboxylate (PubChem CID 139090340) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is methyl (4aS,5S,8aR)-5-methoxy-1-(4-methylphenyl)sulfonyl-2,7-dioxo-5,6,8,8a-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (4aS,5S,8aR)-5-methoxy-1-(4-methylphenyl)sulfonyl-2,7-dioxo-5,6,8,8a-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 139090340 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | methyl (4aS,5S,8aR)-5-methoxy-1-(4-methylphenyl)sulfonyl-2,7-dioxo-5,6,8,8a-tetrahydroquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C=CC(=O)N(S(=O)(=O)c3ccc(C)cc3)[C@@H]1CC(=O)C[C@@H]2OC |
| InChI | InChI=1S/C19H21NO7S/c1-12-4-6-14(7-5-12)28(24,25)20-15-10-13(21)11-16(26-2)19(15,18(23)27-3)9-8-17(20)22/h4-9,15-16H,10-11H2,1-3H3/t15-,16+,19+/m1/s1 |
| InChIKey | SBJBYYIUHQNLFO-GJYPPUQNSA-N |
| XLogP | 0.99 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |