C62H64N4O14 — CID 139090394
4-O-ethyl 6-O,7-O-dimethyl (3S,3aR,4R,9aR)-2,3-dibenzyl-1-oxo-3a,4,9,9a-tetrahydro-3H-pyrrolo[3,4-f]indolizine-4,6,7-tricarboxylate (PubChem CID 139090394) has the molecular formula C62H64N4O14 and a molecular weight of 1089.21 g/mol. Its IUPAC name is 4-O-ethyl 6-O,7-O-dimethyl (3S,3aR,4R,9aR)-2,3-dibenzyl-1-oxo-3a,4,9,9a-tetrahydro-3H-pyrrolo[3,4-f]indolizine-4,6,7-tricarboxylate.
| Compound Name | 4-O-ethyl 6-O,7-O-dimethyl (3S,3aR,4R,9aR)-2,3-dibenzyl-1-oxo-3a,4,9,9a-tetrahydro-3H-pyrrolo[3,4-f]indolizine-4,6,7-tricarboxylate |
|---|---|
| PubChem CID | 139090394 |
| Molecular Formula | C62H64N4O14 |
| Molecular Weight | 1089.21 g/mol |
| Exact Mass | 1088.44 |
| IUPAC Name | 4-O-ethyl 6-O,7-O-dimethyl (3S,3aR,4R,9aR)-2,3-dibenzyl-1-oxo-3a,4,9,9a-tetrahydro-3H-pyrrolo[3,4-f]indolizine-4,6,7-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2[C@@H](Cc3cc(C(=O)OC)c(C(=O)OC)n31)C(=O)N(Cc1ccccc1)[C@H]2Cc1ccccc1.CCOC(=O)[C@H]1[C@@H]2[C@@H](Cc3cc(C(=O)OC)c(C(=O)OC)n31)C(=O)N(Cc1ccccc1)[C@H]2Cc1ccccc1 |
| InChI | InChI=1S/2C31H32N2O7/c2*1-4-40-31(37)27-25-22(16-21-17-23(29(35)38-2)26(33(21)27)30(36)39-3)28(34)32(18-20-13-9-6-10-14-20)24(25)15-19-11-7-5-8-12-19/h2*5-14,17,22,24-25,27H,4,15-16,18H2,1-3H3/t2*22-,24+,25-,27-/m11/s1 |
| InChIKey | GDUYCBCDTYBLIE-NUYDLXDYSA-N |
| XLogP | 7.22 |
| TPSA | 208.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1089.21 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|