C12H15FO2S — CID 139090414
trans-(1S,2S)-2-[(S)-(4-fluorophenyl)sulfinyl]cyclohexan-1-ol (PubChem CID 139090414) has the molecular formula C12H15FO2S and a molecular weight of 242.31 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(S)-(4-fluorophenyl)sulfinyl]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(S)-(4-fluorophenyl)sulfinyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 139090414 |
| Molecular Formula | C12H15FO2S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | trans-(1S,2S)-2-[(S)-(4-fluorophenyl)sulfinyl]cyclohexan-1-ol |
| SMILES | O=[S@](c1ccc(F)cc1)[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H15FO2S/c13-9-5-7-10(8-6-9)16(15)12-4-2-1-3-11(12)14/h5-8,11-12,14H,1-4H2/t11-,12-,16+/m0/s1 |
| InChIKey | RSAFUDGNKBNNRA-MQIPJXDCSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |