About methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide
methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide (PubChem CID 139090513) has the molecular formula C24H24N4O3S
and a molecular weight of 448.55 g/mol. Its IUPAC name is methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide |
| PubChem CID | 139090513 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide |
| SMILES | CS(C)=O.O=C(Nc1ccccc1)Nc1cccc2cc(C(=O)Nc3ccccc3)[nH]c12 |
| InChI | InChI=1S/C22H18N4O2.C2H6OS/c27-21(23-16-9-3-1-4-10-16)19-14-15-8-7-13-18(20(15)25-19)26-22(28)24-17-11-5-2-6-12-17;1-4(2)3/h1-14,25H,(H,23,27)(H2,24,26,28);1-2H3 |
| InChIKey | RBVQHKIOAVAJSZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide?
The IUPAC name of methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide (CID 139090513) is methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide.
What is the SMILES notation for methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide?
The canonical SMILES for methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide is CS(C)=O.O=C(Nc1ccccc1)Nc1cccc2cc(C(=O)Nc3ccccc3)[nH]c12.
What is the InChIKey of methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide?
The InChIKey is RBVQHKIOAVAJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O2.C2H6OS/c27-21(23-16-9-3-1-4-10-16)19-14-15-8-7-13-18(20(15)25-19)26-22(28)24-17-11-5-2-6-12-17;1-4(2)3/h1-14,25H,(H,23,27)(H2,24,26,28);1-2H3.
What are the key properties of methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide?
methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide has a molecular weight of 448.55 g/mol, XLogP of 5.06, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylmethane;N-phenyl-7-(phenylcarbamoylamino)-1H-indole-2-carboxamide is sourced from PubChem (CID 139090513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).