C28H36O6S2 — CID 139090629
(1S,2R,3S)-3-(benzenesulfonyl)-2-methylcyclohept-4-en-1-ol (PubChem CID 139090629) has the molecular formula C28H36O6S2 and a molecular weight of 532.72 g/mol. Its IUPAC name is (1S,2R,3S)-3-(benzenesulfonyl)-2-methylcyclohept-4-en-1-ol.
| Compound Name | (1S,2R,3S)-3-(benzenesulfonyl)-2-methylcyclohept-4-en-1-ol |
|---|---|
| PubChem CID | 139090629 |
| Molecular Formula | C28H36O6S2 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (1S,2R,3S)-3-(benzenesulfonyl)-2-methylcyclohept-4-en-1-ol |
| SMILES | C[C@@H]1[C@@H](O)CCC=C[C@@H]1S(=O)(=O)c1ccccc1.C[C@@H]1[C@@H](O)CCC=C[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/2C14H18O3S/c2*1-11-13(15)9-5-6-10-14(11)18(16,17)12-7-3-2-4-8-12/h2*2-4,6-8,10-11,13-15H,5,9H2,1H3/t2*11-,13+,14+/m11/s1 |
| InChIKey | UOUXBGOAALHOQG-CPUWRQTQSA-N |
| XLogP | 4.35 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|