C26H36F3NO2 — CID 139090762
(2R)-3,3,3-trifluoro-2-methoxy-N-[(2S,3E,5E)-6-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hexa-3,5-dien-2-yl]-2-phenylpropanamide (PubChem CID 139090762) has the molecular formula C26H36F3NO2 and a molecular weight of 451.57 g/mol. Its IUPAC name is (2R)-3,3,3-trifluoro-2-methoxy-N-[(2S,3E,5E)-6-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hexa-3,5-dien-2-yl]-2-phenylpropanamide.
| Compound Name | (2R)-3,3,3-trifluoro-2-methoxy-N-[(2S,3E,5E)-6-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hexa-3,5-dien-2-yl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 139090762 |
| Molecular Formula | C26H36F3NO2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | (2R)-3,3,3-trifluoro-2-methoxy-N-[(2S,3E,5E)-6-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hexa-3,5-dien-2-yl]-2-phenylpropanamide |
| SMILES | CO[C@@](C(=O)N[C@@H](C)/C=C/C=C/[C@@H]1C[C@H](C)CC[C@H]1C(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H36F3NO2/c1-18(2)23-16-15-19(3)17-21(23)12-10-9-11-20(4)30-24(31)25(32-5,26(27,28)29)22-13-7-6-8-14-22/h6-14,18-21,23H,15-17H2,1-5H3,(H,30,31)/b11-9+,12-10+/t19-,20+,21-,23+,25-/m1/s1 |
| InChIKey | IJLWVRSCYWHHPQ-VYQNHQHNSA-N |
| XLogP | 6.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|