C14H16O4 — CID 139090806
(1R,5S,6R,14R)-4-oxo-3-oxatricyclo[7.4.1.05,14]tetradeca-8,12-diene-6-carboxylic acid (PubChem CID 139090806) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (1R,5S,6R,14R)-4-oxo-3-oxatricyclo[7.4.1.05,14]tetradeca-8,12-diene-6-carboxylic acid.
| Compound Name | (1R,5S,6R,14R)-4-oxo-3-oxatricyclo[7.4.1.05,14]tetradeca-8,12-diene-6-carboxylic acid |
|---|---|
| PubChem CID | 139090806 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1R,5S,6R,14R)-4-oxo-3-oxatricyclo[7.4.1.05,14]tetradeca-8,12-diene-6-carboxylic acid |
| SMILES | O=C1OC[C@@H]2C=CCCC3=CC[C@@H](C(=O)O)[C@@H]1[C@H]32 |
| InChI | InChI=1S/C14H16O4/c15-13(16)10-6-5-8-3-1-2-4-9-7-18-14(17)12(10)11(8)9/h2,4-5,9-12H,1,3,6-7H2,(H,15,16)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | FUQUWRBYLDHNFO-IRCOFANPSA-N |
| XLogP | 1.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|