About 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole
5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole (PubChem CID 139090842) has the molecular formula C26H26N2O2S
and a molecular weight of 430.57 g/mol. Its IUPAC name is 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole.
Molecular Properties
| Compound Name | 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole |
| PubChem CID | 139090842 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole |
| SMILES | CCCCc1c(S(=O)(=O)c2ccc(C)cc2)c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C26H26N2O2S/c1-3-4-15-24-26(31(29,30)23-18-16-20(2)17-19-23)25(21-11-7-5-8-12-21)27-28(24)22-13-9-6-10-14-22/h5-14,16-19H,3-4,15H2,1-2H3 |
| InChIKey | GFSHCSOAQGCKQM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole?
The IUPAC name of 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole (CID 139090842) is 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole.
What is the SMILES notation for 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole?
The canonical SMILES for 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole is CCCCc1c(S(=O)(=O)c2ccc(C)cc2)c(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole?
The InChIKey is GFSHCSOAQGCKQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2O2S/c1-3-4-15-24-26(31(29,30)23-18-16-20(2)17-19-23)25(21-11-7-5-8-12-21)27-28(24)22-13-9-6-10-14-22/h5-14,16-19H,3-4,15H2,1-2H3.
What are the key properties of 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole?
5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole has a molecular weight of 430.57 g/mol, XLogP of 6.02, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-4-(4-methylphenyl)sulfonyl-1,3-diphenylpyrazole is sourced from PubChem (CID 139090842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).