About (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one
(4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one (PubChem CID 139091000) has the molecular formula C50H50N2O6
and a molecular weight of 774.96 g/mol. Its IUPAC name is (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one |
| PubChem CID | 139091000 |
| Molecular Formula | C50H50N2O6 |
| Molecular Weight | 774.96 g/mol |
| Exact Mass | 774.37 |
| IUPAC Name | (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OC[C@@H]([C@H](Cc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)O1.O=C1OC[C@@H]([C@H](Cc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)O1 |
| InChI | InChI=1S/2C25H25NO3/c2*27-25-28-19-24(29-25)23(16-20-10-4-1-5-11-20)26(17-21-12-6-2-7-13-21)18-22-14-8-3-9-15-22/h2*1-15,23-24H,16-19H2/t2*23-,24-/m00/s1 |
| InChIKey | KHZSGJSYURXPCX-LMOWBSTHSA-N |
| XLogP | 9.67 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 774.96 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one?
The IUPAC name of (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one (CID 139091000) is (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one.
What is the SMILES notation for (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one?
The canonical SMILES for (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one is O=C1OC[C@@H]([C@H](Cc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)O1.O=C1OC[C@@H]([C@H](Cc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)O1.
What is the InChIKey of (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one?
The InChIKey is KHZSGJSYURXPCX-LMOWBSTHSA-N. The full InChI is InChI=1S/2C25H25NO3/c2*27-25-28-19-24(29-25)23(16-20-10-4-1-5-11-20)26(17-21-12-6-2-7-13-21)18-22-14-8-3-9-15-22/h2*1-15,23-24H,16-19H2/t2*23-,24-/m00/s1.
What are the key properties of (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one?
(4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one has a molecular weight of 774.96 g/mol, XLogP of 9.67, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one is sourced from PubChem (CID 139091000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).