About (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one
(6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one (PubChem CID 139091087) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one.
Molecular Properties
| Compound Name | (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one |
| PubChem CID | 139091087 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one |
| SMILES | CC[C@H]1CCCCC(=O)[C@@H]1[C@H]1CCCC(=O)N1 |
| InChI | InChI=1S/C14H23NO2/c1-2-10-6-3-4-8-12(16)14(10)11-7-5-9-13(17)15-11/h10-11,14H,2-9H2,1H3,(H,15,17)/t10-,11+,14-/m0/s1 |
| InChIKey | OIEOUQZHRVDTFO-WDMOLILDSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one?
The IUPAC name of (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one (CID 139091087) is (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one.
What is the SMILES notation for (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one?
The canonical SMILES for (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one is CC[C@H]1CCCCC(=O)[C@@H]1[C@H]1CCCC(=O)N1.
What is the InChIKey of (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one?
The InChIKey is OIEOUQZHRVDTFO-WDMOLILDSA-N. The full InChI is InChI=1S/C14H23NO2/c1-2-10-6-3-4-8-12(16)14(10)11-7-5-9-13(17)15-11/h10-11,14H,2-9H2,1H3,(H,15,17)/t10-,11+,14-/m0/s1.
What are the key properties of (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one?
(6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one has a molecular weight of 237.34 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-[(1S,2S)-2-ethyl-7-oxocycloheptyl]piperidin-2-one is sourced from PubChem (CID 139091087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).