About [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate
[(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate (PubChem CID 139091094) has the molecular formula C12H14O4S
and a molecular weight of 254.31 g/mol. Its IUPAC name is [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate |
| PubChem CID | 139091094 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)/C=C\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O4S/c1-10(16-11(2)13)8-9-17(14,15)12-6-4-3-5-7-12/h3-10H,1-2H3/b9-8-/t10-/m1/s1 |
| InChIKey | ANBPHSWUYUIAHW-HSTULFTRSA-N |
| XLogP | 1.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate?
The IUPAC name of [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate (CID 139091094) is [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate.
What is the SMILES notation for [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate?
The canonical SMILES for [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate is CC(=O)O[C@H](C)/C=C\S(=O)(=O)c1ccccc1.
What is the InChIKey of [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate?
The InChIKey is ANBPHSWUYUIAHW-HSTULFTRSA-N. The full InChI is InChI=1S/C12H14O4S/c1-10(16-11(2)13)8-9-17(14,15)12-6-4-3-5-7-12/h3-10H,1-2H3/b9-8-/t10-/m1/s1.
What are the key properties of [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate?
[(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate has a molecular weight of 254.31 g/mol, XLogP of 1.93, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2R)-4-(benzenesulfonyl)but-3-en-2-yl] acetate is sourced from PubChem (CID 139091094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).