C24H22O4 — CID 139091114
ethyl (2E)-2-[(13bS)-6-methyl-8,13-dioxo-2,3,7,13b-tetrahydrocyclohepta[a]anthracen-1-ylidene]acetate (PubChem CID 139091114) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl (2E)-2-[(13bS)-6-methyl-8,13-dioxo-2,3,7,13b-tetrahydrocyclohepta[a]anthracen-1-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(13bS)-6-methyl-8,13-dioxo-2,3,7,13b-tetrahydrocyclohepta[a]anthracen-1-ylidene]acetate |
|---|---|
| PubChem CID | 139091114 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | ethyl (2E)-2-[(13bS)-6-methyl-8,13-dioxo-2,3,7,13b-tetrahydrocyclohepta[a]anthracen-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CCC=CC2=C(C)CC3=C(C(=O)c4ccccc4C3=O)[C@H]21 |
| InChI | InChI=1S/C24H22O4/c1-3-28-20(25)13-15-8-4-5-9-16-14(2)12-19-22(21(15)16)24(27)18-11-7-6-10-17(18)23(19)26/h5-7,9-11,13,21H,3-4,8,12H2,1-2H3/b15-13+/t21-/m0/s1 |
| InChIKey | FLWDTPGRGALQFC-AXDNMFEOSA-N |
| XLogP | 4.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|