C26H38O6 — CID 139091202
2-[(4S,5R)-5-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-5-methyl-2-oxo-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 139091202) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 2-[(4S,5R)-5-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-5-methyl-2-oxo-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(4S,5R)-5-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-5-methyl-2-oxo-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139091202 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 2-[(4S,5R)-5-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-5-methyl-2-oxo-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | C#CC[C@H]1O[C@@H]([C@]2(C)OC(=O)O[C@H]2CCOC(=O)C(C)(C)C)[C@H]2[C@@H]1C(C)=CC[C@@H]2C(C)C |
| InChI | InChI=1S/C26H38O6/c1-9-10-18-20-16(4)11-12-17(15(2)3)21(20)22(30-18)26(8)19(31-24(28)32-26)13-14-29-23(27)25(5,6)7/h1,11,15,17-22H,10,12-14H2,2-8H3/t17-,18-,19+,20-,21-,22-,26-/m1/s1 |
| InChIKey | ZPWYZZBNDFKBBI-CKYOBCNXSA-N |
| XLogP | 4.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|