C16H12Cl3NO3 — CID 139091219
2,2,2-trichloroethyl (2S)-4-oxo-2-(2-phenylethynyl)-2,3-dihydropyridine-1-carboxylate (PubChem CID 139091219) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S)-4-oxo-2-(2-phenylethynyl)-2,3-dihydropyridine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (2S)-4-oxo-2-(2-phenylethynyl)-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 139091219 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2,2,2-trichloroethyl (2S)-4-oxo-2-(2-phenylethynyl)-2,3-dihydropyridine-1-carboxylate |
| SMILES | O=C1C=CN(C(=O)OCC(Cl)(Cl)Cl)[C@H](C#Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H12Cl3NO3/c17-16(18,19)11-23-15(22)20-9-8-14(21)10-13(20)7-6-12-4-2-1-3-5-12/h1-5,8-9,13H,10-11H2/t13-/m1/s1 |
| InChIKey | AIMOZPGPDBMVLR-CYBMUJFWSA-N |
| XLogP | 3.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|