About [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride
[2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride (PubChem CID 139091348) has the molecular formula C11H20Cl2N2O4
and a molecular weight of 315.20 g/mol. Its IUPAC name is [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride.
Molecular Properties
| Compound Name | [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride |
| PubChem CID | 139091348 |
| Molecular Formula | C11H20Cl2N2O4 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride |
| SMILES | COC(=O)C1([NH3+])CC2(C1)CC([NH3+])(C(=O)OC)C2.[Cl-].[Cl-] |
| InChI | InChI=1S/C11H18N2O4.2ClH/c1-16-7(14)10(12)3-9(4-10)5-11(13,6-9)8(15)17-2;;/h3-6,12-13H2,1-2H3;2*1H |
| InChIKey | ANCLPKAYHNOPTQ-UHFFFAOYSA-N |
| XLogP | -8.12 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | -8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride?
The IUPAC name of [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride (CID 139091348) is [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride.
What is the SMILES notation for [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride?
The canonical SMILES for [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride is COC(=O)C1([NH3+])CC2(C1)CC([NH3+])(C(=O)OC)C2.[Cl-].[Cl-].
What is the InChIKey of [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride?
The InChIKey is ANCLPKAYHNOPTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4.2ClH/c1-16-7(14)10(12)3-9(4-10)5-11(13,6-9)8(15)17-2;;/h3-6,12-13H2,1-2H3;2*1H.
What are the key properties of [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride?
[2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride has a molecular weight of 315.20 g/mol, XLogP of -8.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-azaniumyl-2,6-bis(methoxycarbonyl)spiro[3.3]heptan-6-yl]azanium dichloride is sourced from PubChem (CID 139091348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).