C45H53N3O4Si — CID 139091526
(5S,5aS,8aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-phenyl-3-trityl-4,5,5a,8a-tetrahydropyrrolo[3,4-e]benzimidazole-6,8-dione;ethoxyethane (PubChem CID 139091526) has the molecular formula C45H53N3O4Si and a molecular weight of 728.02 g/mol. Its IUPAC name is (5S,5aS,8aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-phenyl-3-trityl-4,5,5a,8a-tetrahydropyrrolo[3,4-e]benzimidazole-6,8-dione;ethoxyethane.
| Compound Name | (5S,5aS,8aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-phenyl-3-trityl-4,5,5a,8a-tetrahydropyrrolo[3,4-e]benzimidazole-6,8-dione;ethoxyethane |
|---|---|
| PubChem CID | 139091526 |
| Molecular Formula | C45H53N3O4Si |
| Molecular Weight | 728.02 g/mol |
| Exact Mass | 727.38 |
| IUPAC Name | (5S,5aS,8aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-phenyl-3-trityl-4,5,5a,8a-tetrahydropyrrolo[3,4-e]benzimidazole-6,8-dione;ethoxyethane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1Cc2c(ncn2C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]12.CCOCC |
| InChI | InChI=1S/C41H43N3O3Si.C4H10O/c1-40(2,3)48(4,5)47-27-29-26-34-37(36-35(29)38(45)44(39(36)46)33-24-16-9-17-25-33)42-28-43(34)41(30-18-10-6-11-19-30,31-20-12-7-13-21-31)32-22-14-8-15-23-32;1-3-5-4-2/h6-25,28-29,35-36H,26-27H2,1-5H3;3-4H2,1-2H3/t29-,35+,36+;/m1./s1 |
| InChIKey | STFPRJHGJMMXDQ-CMUQDFSQSA-N |
| XLogP | 9.23 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.02 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|