C46H50N2O6 — CID 139091601
(15S,18S,19S)-18-hydroxy-1-[(1S)-1-methoxyethyl]-17,18-dimethyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one (PubChem CID 139091601) has the molecular formula C46H50N2O6 and a molecular weight of 726.91 g/mol. Its IUPAC name is (15S,18S,19S)-18-hydroxy-1-[(1S)-1-methoxyethyl]-17,18-dimethyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one.
| Compound Name | (15S,18S,19S)-18-hydroxy-1-[(1S)-1-methoxyethyl]-17,18-dimethyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one |
|---|---|
| PubChem CID | 139091601 |
| Molecular Formula | C46H50N2O6 |
| Molecular Weight | 726.91 g/mol |
| Exact Mass | 726.37 |
| IUPAC Name | (15S,18S,19S)-18-hydroxy-1-[(1S)-1-methoxyethyl]-17,18-dimethyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one |
| SMILES | CO[C@@H](C)C12c3ccccc3C(c3ccccc31)[C@H]1[C@@H]2C(=O)N(C)[C@@]1(C)O.CO[C@@H](C)C12c3ccccc3C(c3ccccc31)[C@H]1[C@@H]2C(=O)N(C)[C@@]1(C)O |
| InChI | InChI=1S/2C23H25NO3/c2*1-13(27-4)23-16-11-7-5-9-14(16)18(15-10-6-8-12-17(15)23)19-20(23)21(25)24(3)22(19,2)26/h2*5-13,18-20,26H,1-4H3/t2*13-,18?,19-,20+,22-,23?/m00/s1 |
| InChIKey | XTYKCSZXPUKZMT-JALYVYCGSA-N |
| XLogP | 5.76 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |