C19H26O4 — CID 139091627
(4aS,4bS,10aS)-8,8-dimethyl-4-oxospiro[1,2,3,4b,5,6,10,10a-octahydrophenanthrene-7,2'-1,3-dioxolane]-4a-carbaldehyde (PubChem CID 139091627) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (4aS,4bS,10aS)-8,8-dimethyl-4-oxospiro[1,2,3,4b,5,6,10,10a-octahydrophenanthrene-7,2'-1,3-dioxolane]-4a-carbaldehyde.
| Compound Name | (4aS,4bS,10aS)-8,8-dimethyl-4-oxospiro[1,2,3,4b,5,6,10,10a-octahydrophenanthrene-7,2'-1,3-dioxolane]-4a-carbaldehyde |
|---|---|
| PubChem CID | 139091627 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (4aS,4bS,10aS)-8,8-dimethyl-4-oxospiro[1,2,3,4b,5,6,10,10a-octahydrophenanthrene-7,2'-1,3-dioxolane]-4a-carbaldehyde |
| SMILES | CC1(C)C2=CC[C@@H]3CCCC(=O)[C@]3(C=O)[C@H]2CCC12OCCO2 |
| InChI | InChI=1S/C19H26O4/c1-17(2)14-7-6-13-4-3-5-16(21)18(13,12-20)15(14)8-9-19(17)22-10-11-23-19/h7,12-13,15H,3-6,8-11H2,1-2H3/t13-,15-,18-/m0/s1 |
| InChIKey | RBNMJNIVJZNSQL-YEWWUXTCSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|