C34H36F6N2O8 — CID 139091820
diethyl 2-[(1R)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]propanedioate (PubChem CID 139091820) has the molecular formula C34H36F6N2O8 and a molecular weight of 714.66 g/mol. Its IUPAC name is diethyl 2-[(1R)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]propanedioate.
| Compound Name | diethyl 2-[(1R)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]propanedioate |
|---|---|
| PubChem CID | 139091820 |
| Molecular Formula | C34H36F6N2O8 |
| Molecular Weight | 714.66 g/mol |
| Exact Mass | 714.24 |
| IUPAC Name | diethyl 2-[(1R)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](c1c[nH]c2ccccc12)C(F)(F)F.CCOC(=O)C(C(=O)OCC)[C@H](c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/2C17H18F3NO4/c2*1-3-24-15(22)13(16(23)25-4-2)14(17(18,19)20)11-9-21-12-8-6-5-7-10(11)12/h2*5-9,13-14,21H,3-4H2,1-2H3/t2*14-/m00/s1 |
| InChIKey | XWTMZTLIJHOARA-DXZWIFNPSA-N |
| XLogP | 7.11 |
| TPSA | 136.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.66 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|