C28H27NO4S — CID 139091832
ethyl 2-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3,5-diphenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate (PubChem CID 139091832) has the molecular formula C28H27NO4S and a molecular weight of 473.59 g/mol. Its IUPAC name is ethyl 2-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3,5-diphenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3,5-diphenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139091832 |
| Molecular Formula | C28H27NO4S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | ethyl 2-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3,5-diphenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@H]1[C@H](c2ccccc2)C=C(c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H27NO4S/c1-4-33-28(30)21(3)27-25(22-11-7-5-8-12-22)19-26(23-13-9-6-10-14-23)29(27)34(31,32)24-17-15-20(2)16-18-24/h5-19,25,27H,3-4H2,1-2H3/t25-,27-/m0/s1 |
| InChIKey | IRKPUPCUTNVJMZ-BDYUSTAISA-N |
| XLogP | 5.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|