C27H35N5OS2 — CID 139091867
(2S)-1-butyl-3-[(E)-(4-methoxyphenyl)methylideneamino]-1',3'-di(propan-2-yl)spiro[benzimidazole-2,5'-imidazolidine]-2',4'-dithione (PubChem CID 139091867) has the molecular formula C27H35N5OS2 and a molecular weight of 509.75 g/mol. Its IUPAC name is (2S)-1-butyl-3-[(E)-(4-methoxyphenyl)methylideneamino]-1',3'-di(propan-2-yl)spiro[benzimidazole-2,5'-imidazolidine]-2',4'-dithione.
| Compound Name | (2S)-1-butyl-3-[(E)-(4-methoxyphenyl)methylideneamino]-1',3'-di(propan-2-yl)spiro[benzimidazole-2,5'-imidazolidine]-2',4'-dithione |
|---|---|
| PubChem CID | 139091867 |
| Molecular Formula | C27H35N5OS2 |
| Molecular Weight | 509.75 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (2S)-1-butyl-3-[(E)-(4-methoxyphenyl)methylideneamino]-1',3'-di(propan-2-yl)spiro[benzimidazole-2,5'-imidazolidine]-2',4'-dithione |
| SMILES | CCCCN1c2ccccc2N(/N=C/c2ccc(OC)cc2)[C@@]12C(=S)N(C(C)C)C(=S)N2C(C)C |
| InChI | InChI=1S/C27H35N5OS2/c1-7-8-17-29-23-11-9-10-12-24(23)32(28-18-21-13-15-22(33-6)16-14-21)27(29)25(34)30(19(2)3)26(35)31(27)20(4)5/h9-16,18-20H,7-8,17H2,1-6H3/b28-18+/t27-/m0/s1 |
| InChIKey | CLQSTHYMMCGOLA-JXXQQCOQSA-N |
| XLogP | 5.86 |
| TPSA | 34.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|