About 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform
3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform (PubChem CID 139091896) has the molecular formula C33H23Cl3N4S2
and a molecular weight of 646.07 g/mol. Its IUPAC name is 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform.
Molecular Properties
| Compound Name | 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform |
| PubChem CID | 139091896 |
| Molecular Formula | C33H23Cl3N4S2 |
| Molecular Weight | 646.07 g/mol |
| Exact Mass | 644.04 |
| IUPAC Name | 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform |
| SMILES | Cc1cc(-c2ccncc2)sc1-c1cnc2c(ccc3cc(-c4sc(-c5ccncc5)cc4C)cnc32)c1.ClC(Cl)Cl |
| InChI | InChI=1S/C32H22N4S2.CHCl3/c1-19-13-27(21-5-9-33-10-6-21)37-31(19)25-15-23-3-4-24-16-26(18-36-30(24)29(23)35-17-25)32-20(2)14-28(38-32)22-7-11-34-12-8-22;2-1(3)4/h3-18H,1-2H3;1H |
| InChIKey | AIGBJSUKJDIKDR-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 646.07 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform?
The IUPAC name of 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform (CID 139091896) is 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform.
What is the SMILES notation for 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform?
The canonical SMILES for 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform is Cc1cc(-c2ccncc2)sc1-c1cnc2c(ccc3cc(-c4sc(-c5ccncc5)cc4C)cnc32)c1.ClC(Cl)Cl.
What is the InChIKey of 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform?
The InChIKey is AIGBJSUKJDIKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H22N4S2.CHCl3/c1-19-13-27(21-5-9-33-10-6-21)37-31(19)25-15-23-3-4-24-16-26(18-36-30(24)29(23)35-17-25)32-20(2)14-28(38-32)22-7-11-34-12-8-22;2-1(3)4/h3-18H,1-2H3;1H.
What are the key properties of 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform?
3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform has a molecular weight of 646.07 g/mol, XLogP of 10.97, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-bis(3-methyl-5-pyridin-4-ylthiophen-2-yl)-1,10-phenanthroline;chloroform is sourced from PubChem (CID 139091896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).