C29H26N2O2 — CID 139091926
(2S,5S,6R)-5,6-diphenyl-14-oxa-3,7-diazapentacyclo[13.4.0.02,7.03,5.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;methanol (PubChem CID 139091926) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is (2S,5S,6R)-5,6-diphenyl-14-oxa-3,7-diazapentacyclo[13.4.0.02,7.03,5.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;methanol.
| Compound Name | (2S,5S,6R)-5,6-diphenyl-14-oxa-3,7-diazapentacyclo[13.4.0.02,7.03,5.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;methanol |
|---|---|
| PubChem CID | 139091926 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (2S,5S,6R)-5,6-diphenyl-14-oxa-3,7-diazapentacyclo[13.4.0.02,7.03,5.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;methanol |
| SMILES | CO.c1ccc([C@H]2N3c4ccccc4Oc4ccccc4[C@H]3N3C[C@@]23c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N2O.CH4O/c1-3-11-20(12-4-1)26-28(21-13-5-2-6-14-21)19-29(28)27-22-15-7-9-17-24(22)31-25-18-10-8-16-23(25)30(26)27;1-2/h1-18,26-27H,19H2;2H,1H3/t26-,27+,28-,29?;/m1./s1 |
| InChIKey | VAXYGCIDNVWFAK-GPPZBOADSA-N |
| XLogP | 5.87 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|