C19H19FS — CID 139091997
(4R,4aR,10bS)-4-(2-fluorophenyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isothiochromene (PubChem CID 139091997) has the molecular formula C19H19FS and a molecular weight of 298.43 g/mol. Its IUPAC name is (4R,4aR,10bS)-4-(2-fluorophenyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isothiochromene.
| Compound Name | (4R,4aR,10bS)-4-(2-fluorophenyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isothiochromene |
|---|---|
| PubChem CID | 139091997 |
| Molecular Formula | C19H19FS |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (4R,4aR,10bS)-4-(2-fluorophenyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isothiochromene |
| SMILES | Fc1ccccc1[C@@H]1SCC[C@@H]2c3ccccc3CC[C@H]21 |
| InChI | InChI=1S/C19H19FS/c20-18-8-4-3-7-17(18)19-16-10-9-13-5-1-2-6-14(13)15(16)11-12-21-19/h1-8,15-16,19H,9-12H2/t15-,16-,19-/m1/s1 |
| InChIKey | DTVQSKDBRGHQRS-GPMSIDNRSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |