About diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate
diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate (PubChem CID 139092038) has the molecular formula C37H35NO4
and a molecular weight of 557.69 g/mol. Its IUPAC name is diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate |
| PubChem CID | 139092038 |
| Molecular Formula | C37H35NO4 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)C(=C(c2ccccc2)c2ccccc2)N(C)[C@]1(Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C37H35NO4/c1-4-41-35(39)33-32(30-24-16-9-17-25-30)34(31(28-20-12-7-13-21-28)29-22-14-8-15-23-29)38(3)37(33,36(40)42-5-2)26-27-18-10-6-11-19-27/h6-25H,4-5,26H2,1-3H3/t37-/m0/s1 |
| InChIKey | LMQBKYXTKMXAJL-QNGWXLTQSA-N |
| XLogP | 6.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate?
The IUPAC name of diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate (CID 139092038) is diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate.
What is the SMILES notation for diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate?
The canonical SMILES for diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate is CCOC(=O)C1=C(c2ccccc2)C(=C(c2ccccc2)c2ccccc2)N(C)[C@]1(Cc1ccccc1)C(=O)OCC.
What is the InChIKey of diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate?
The InChIKey is LMQBKYXTKMXAJL-QNGWXLTQSA-N. The full InChI is InChI=1S/C37H35NO4/c1-4-41-35(39)33-32(30-24-16-9-17-25-30)34(31(28-20-12-7-13-21-28)29-22-14-8-15-23-29)38(3)37(33,36(40)42-5-2)26-27-18-10-6-11-19-27/h6-25H,4-5,26H2,1-3H3/t37-/m0/s1.
What are the key properties of diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate?
diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate has a molecular weight of 557.69 g/mol, XLogP of 6.95, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2S)-5-benzhydrylidene-2-benzyl-1-methyl-4-phenylpyrrole-2,3-dicarboxylate is sourced from PubChem (CID 139092038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).