C18H30O3 — CID 139092132
(1R,3R,5S,7R,9S,12R)-1,9-dimethyl-3,5-dipropyl-4,8,13-trioxatetracyclo[10.1.0.03,5.07,9]tridecane (PubChem CID 139092132) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1R,3R,5S,7R,9S,12R)-1,9-dimethyl-3,5-dipropyl-4,8,13-trioxatetracyclo[10.1.0.03,5.07,9]tridecane.
| Compound Name | (1R,3R,5S,7R,9S,12R)-1,9-dimethyl-3,5-dipropyl-4,8,13-trioxatetracyclo[10.1.0.03,5.07,9]tridecane |
|---|---|
| PubChem CID | 139092132 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (1R,3R,5S,7R,9S,12R)-1,9-dimethyl-3,5-dipropyl-4,8,13-trioxatetracyclo[10.1.0.03,5.07,9]tridecane |
| SMILES | CCC[C@@]12C[C@@]3(C)O[C@@H]3CC[C@]3(C)O[C@@H]3C[C@]1(CCC)O2 |
| InChI | InChI=1S/C18H30O3/c1-5-8-17-11-14-15(3,20-14)10-7-13-16(4,19-13)12-18(17,21-17)9-6-2/h13-14H,5-12H2,1-4H3/t13-,14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | FCZSKIQBGWDLTL-LVZMMCSGSA-N |
| XLogP | 3.98 |
| TPSA | 37.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|