C38H16Br4F10N4 — CID 139092313
2,3,9,10-tetrabromo-6,13-bis(2,3,4,5,6-pentafluorophenyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene;toluene (PubChem CID 139092313) has the molecular formula C38H16Br4F10N4 and a molecular weight of 1038.17 g/mol. Its IUPAC name is 2,3,9,10-tetrabromo-6,13-bis(2,3,4,5,6-pentafluorophenyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene;toluene.
| Compound Name | 2,3,9,10-tetrabromo-6,13-bis(2,3,4,5,6-pentafluorophenyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene;toluene |
|---|---|
| PubChem CID | 139092313 |
| Molecular Formula | C38H16Br4F10N4 |
| Molecular Weight | 1038.17 g/mol |
| Exact Mass | 1033.79 |
| IUPAC Name | 2,3,9,10-tetrabromo-6,13-bis(2,3,4,5,6-pentafluorophenyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene;toluene |
| SMILES | Cc1ccccc1.Cc1ccccc1.Fc1c(F)c(F)c(-c2nc3c(Br)c(Br)c4nc(-c5c(F)c(F)c(F)c(F)c5F)nc5c(Br)c(Br)c(n2)c3c45)c(F)c1F |
| InChI | InChI=1S/C24Br4F10N4.2C7H8/c25-5-7(27)21-2-1-19(5)39-23(3-9(29)13(33)17(37)14(34)10(3)30)40-20(1)6(26)8(28)22(2)42-24(41-21)4-11(31)15(35)18(38)16(36)12(4)32;2*1-7-5-3-2-4-6-7/h;2*2-6H,1H3 |
| InChIKey | GFFGDHYUWXHZIP-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.17 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|