C32H32BrN5O7 — CID 139092438
[(4R,5S,6R,7R,8R,9S)-7-(3-acetylanilino)-6-azido-8,9-dihydroxy-2-(4-methoxyphenyl)-4,9-dimethyl-3-oxa-1-azaspiro[4.4]non-1-en-8-yl]methyl 4-bromobenzoate (PubChem CID 139092438) has the molecular formula C32H32BrN5O7 and a molecular weight of 678.54 g/mol. Its IUPAC name is [(4R,5S,6R,7R,8R,9S)-7-(3-acetylanilino)-6-azido-8,9-dihydroxy-2-(4-methoxyphenyl)-4,9-dimethyl-3-oxa-1-azaspiro[4.4]non-1-en-8-yl]methyl 4-bromobenzoate.
| Compound Name | [(4R,5S,6R,7R,8R,9S)-7-(3-acetylanilino)-6-azido-8,9-dihydroxy-2-(4-methoxyphenyl)-4,9-dimethyl-3-oxa-1-azaspiro[4.4]non-1-en-8-yl]methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 139092438 |
| Molecular Formula | C32H32BrN5O7 |
| Molecular Weight | 678.54 g/mol |
| Exact Mass | 677.15 |
| IUPAC Name | [(4R,5S,6R,7R,8R,9S)-7-(3-acetylanilino)-6-azido-8,9-dihydroxy-2-(4-methoxyphenyl)-4,9-dimethyl-3-oxa-1-azaspiro[4.4]non-1-en-8-yl]methyl 4-bromobenzoate |
| SMILES | COc1ccc(C2=N[C@@]3([C@H](N=[N+]=[N-])[C@@H](Nc4cccc(C(C)=O)c4)[C@@](O)(COC(=O)c4ccc(Br)cc4)[C@@]3(C)O)[C@@H](C)O2)cc1 |
| InChI | InChI=1S/C32H32BrN5O7/c1-18(39)22-6-5-7-24(16-22)35-26-27(37-38-34)32(19(2)45-28(36-32)20-10-14-25(43-4)15-11-20)30(3,41)31(26,42)17-44-29(40)21-8-12-23(33)13-9-21/h5-16,19,26-27,35,41-42H,17H2,1-4H3/t19-,26-,27-,30-,31+,32-/m1/s1 |
| InChIKey | XWMRPLNSGVZIHJ-PARWYMDRSA-N |
| XLogP | 5.08 |
| TPSA | 175.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|