C48H42F2N4O4S2 — CID 139092499
(1S)-1-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole;(1R)-1-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 139092499) has the molecular formula C48H42F2N4O4S2 and a molecular weight of 841.02 g/mol. Its IUPAC name is (1S)-1-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole;(1R)-1-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | (1S)-1-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole;(1R)-1-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 139092499 |
| Molecular Formula | C48H42F2N4O4S2 |
| Molecular Weight | 841.02 g/mol |
| Exact Mass | 840.26 |
| IUPAC Name | (1S)-1-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole;(1R)-1-(4-fluorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3[nH]c4ccccc4c3[C@@H]2c2ccc(F)cc2)cc1.Cc1ccc(S(=O)(=O)N2CCc3[nH]c4ccccc4c3[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/2C24H21FN2O2S/c2*1-16-6-12-19(13-7-16)30(28,29)27-15-14-22-23(20-4-2-3-5-21(20)26-22)24(27)17-8-10-18(25)11-9-17/h2*2-13,24,26H,14-15H2,1H3/t2*24-/m10/s1 |
| InChIKey | CGDJGHZFBHACRY-STCDVQFJSA-N |
| XLogP | 9.90 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.02 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|