C21H36O2 — CID 139092509
(1S,3R)-1,3-dicyclohexyl-2-(3,3-dimethylbut-1-ynyl)propane-1,3-diol (PubChem CID 139092509) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (1S,3R)-1,3-dicyclohexyl-2-(3,3-dimethylbut-1-ynyl)propane-1,3-diol.
| Compound Name | (1S,3R)-1,3-dicyclohexyl-2-(3,3-dimethylbut-1-ynyl)propane-1,3-diol |
|---|---|
| PubChem CID | 139092509 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (1S,3R)-1,3-dicyclohexyl-2-(3,3-dimethylbut-1-ynyl)propane-1,3-diol |
| SMILES | CC(C)(C)C#CC([C@H](O)C1CCCCC1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C21H36O2/c1-21(2,3)15-14-18(19(22)16-10-6-4-7-11-16)20(23)17-12-8-5-9-13-17/h16-20,22-23H,4-13H2,1-3H3/t18?,19-,20+ |
| InChIKey | BNDUNVZGDBZEDK-IHWFROFDSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|