C18H27F3NO5P — CID 139092644
ethyl (3S,4R)-3-diethoxyphosphoryl-5,5,5-trifluoro-4-(4-methylanilino)pentanoate (PubChem CID 139092644) has the molecular formula C18H27F3NO5P and a molecular weight of 425.38 g/mol. Its IUPAC name is ethyl (3S,4R)-3-diethoxyphosphoryl-5,5,5-trifluoro-4-(4-methylanilino)pentanoate.
| Compound Name | ethyl (3S,4R)-3-diethoxyphosphoryl-5,5,5-trifluoro-4-(4-methylanilino)pentanoate |
|---|---|
| PubChem CID | 139092644 |
| Molecular Formula | C18H27F3NO5P |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl (3S,4R)-3-diethoxyphosphoryl-5,5,5-trifluoro-4-(4-methylanilino)pentanoate |
| SMILES | CCOC(=O)C[C@@H]([C@H](Nc1ccc(C)cc1)C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H27F3NO5P/c1-5-25-16(23)12-15(28(24,26-6-2)27-7-3)17(18(19,20)21)22-14-10-8-13(4)9-11-14/h8-11,15,17,22H,5-7,12H2,1-4H3/t15-,17-/m0/s1 |
| InChIKey | ADEDRRSXOZFHFO-RDJZCZTQSA-N |
| XLogP | 4.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|