C28H36O6 — CID 139092780
(1R,2R,6S,9R,10R)-4,4-dimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one (PubChem CID 139092780) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is (1R,2R,6S,9R,10R)-4,4-dimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one.
| Compound Name | (1R,2R,6S,9R,10R)-4,4-dimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one |
|---|---|
| PubChem CID | 139092780 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | (1R,2R,6S,9R,10R)-4,4-dimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one |
| SMILES | CC1(C)O[C@H]2C=C[C@@H]3[C@H]4C(=O)CCC[C@@]34[C@H]2O1.CC1(C)O[C@H]2C=C[C@@H]3[C@H]4C(=O)CCC[C@@]34[C@H]2O1 |
| InChI | InChI=1S/2C14H18O3/c2*1-13(2)16-10-6-5-8-11-9(15)4-3-7-14(8,11)12(10)17-13/h2*5-6,8,10-12H,3-4,7H2,1-2H3/t2*8-,10+,11+,12+,14-/m11/s1 |
| InChIKey | YMKHFBGJMVAUCZ-LCNMGSOQSA-N |
| XLogP | 4.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|