C64H50N6 — CID 139092937
N,N-diphenyl-4-[(E)-2-[4-(pyridin-2-ylmethylideneamino)phenyl]ethenyl]aniline (PubChem CID 139092937) has the molecular formula C64H50N6 and a molecular weight of 903.15 g/mol. Its IUPAC name is N,N-diphenyl-4-[(E)-2-[4-(pyridin-2-ylmethylideneamino)phenyl]ethenyl]aniline.
| Compound Name | N,N-diphenyl-4-[(E)-2-[4-(pyridin-2-ylmethylideneamino)phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 139092937 |
| Molecular Formula | C64H50N6 |
| Molecular Weight | 903.15 g/mol |
| Exact Mass | 902.41 |
| IUPAC Name | N,N-diphenyl-4-[(E)-2-[4-(pyridin-2-ylmethylideneamino)phenyl]ethenyl]aniline |
| SMILES | C(=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)\c1ccc(/N=C/c2ccccn2)cc1.C(=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)\c1ccc(/N=C/c2ccccn2)cc1 |
| InChI | InChI=1S/2C32H25N3/c2*1-3-10-30(11-4-1)35(31-12-5-2-6-13-31)32-22-18-27(19-23-32)15-14-26-16-20-28(21-17-26)34-25-29-9-7-8-24-33-29/h2*1-25H/b2*15-14+,34-25+ |
| InChIKey | CSSRSRUZPBYDNS-GOTMYKICSA-N |
| XLogP | 16.94 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.15 |
| LogP ≤ 5 | 16.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|