C30H26F2O3 — CID 139093392
(2S,3R,4R,5S)-3,4-bis(4-fluorophenyl)-2,5-bis(4-methoxyphenyl)oxolane (PubChem CID 139093392) has the molecular formula C30H26F2O3 and a molecular weight of 472.53 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3,4-bis(4-fluorophenyl)-2,5-bis(4-methoxyphenyl)oxolane.
| Compound Name | (2S,3R,4R,5S)-3,4-bis(4-fluorophenyl)-2,5-bis(4-methoxyphenyl)oxolane |
|---|---|
| PubChem CID | 139093392 |
| Molecular Formula | C30H26F2O3 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | (2S,3R,4R,5S)-3,4-bis(4-fluorophenyl)-2,5-bis(4-methoxyphenyl)oxolane |
| SMILES | COc1ccc([C@H]2O[C@H](c3ccc(OC)cc3)[C@@H](c3ccc(F)cc3)[C@@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H26F2O3/c1-33-25-15-7-21(8-16-25)29-27(19-3-11-23(31)12-4-19)28(20-5-13-24(32)14-6-20)30(35-29)22-9-17-26(34-2)18-10-22/h3-18,27-30H,1-2H3/t27-,28-,29+,30+/m0/s1 |
| InChIKey | PNWAIHVTRBPHFH-VZNYXHRGSA-N |
| XLogP | 7.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |