C14H22O4 — CID 139093505
(4aS,5S,6R,8aR)-6-hydroxy-1,1-dimethoxy-4a,5-dimethyl-6,7,8,8a-tetrahydro-5H-naphthalen-2-one (PubChem CID 139093505) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (4aS,5S,6R,8aR)-6-hydroxy-1,1-dimethoxy-4a,5-dimethyl-6,7,8,8a-tetrahydro-5H-naphthalen-2-one.
| Compound Name | (4aS,5S,6R,8aR)-6-hydroxy-1,1-dimethoxy-4a,5-dimethyl-6,7,8,8a-tetrahydro-5H-naphthalen-2-one |
|---|---|
| PubChem CID | 139093505 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (4aS,5S,6R,8aR)-6-hydroxy-1,1-dimethoxy-4a,5-dimethyl-6,7,8,8a-tetrahydro-5H-naphthalen-2-one |
| SMILES | COC1(OC)C(=O)C=C[C@@]2(C)[C@H](C)[C@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C14H22O4/c1-9-10(15)5-6-11-13(9,2)8-7-12(16)14(11,17-3)18-4/h7-11,15H,5-6H2,1-4H3/t9-,10-,11-,13+/m1/s1 |
| InChIKey | YGYMXTZOTOWIAI-UZWSLXQKSA-N |
| XLogP | 1.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|