About [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone
[(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone (PubChem CID 139093565) has the molecular formula C36H36O4
and a molecular weight of 532.68 g/mol. Its IUPAC name is [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone.
Molecular Properties
| Compound Name | [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone |
| PubChem CID | 139093565 |
| Molecular Formula | C36H36O4 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1CCC[C@]1(O)c1ccccc1.O=C(c1ccccc1)[C@H]1CCC[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/2C18H18O2/c2*19-17(14-8-3-1-4-9-14)16-12-7-13-18(16,20)15-10-5-2-6-11-15/h2*1-6,8-11,16,20H,7,12-13H2/t2*16-,18+/m11/s1 |
| InChIKey | MZPWPYSHMFHRFW-RQSISSSHSA-N |
| XLogP | 7.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone?
The IUPAC name of [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone (CID 139093565) is [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone.
What is the SMILES notation for [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone?
The canonical SMILES for [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone is O=C(c1ccccc1)[C@H]1CCC[C@]1(O)c1ccccc1.O=C(c1ccccc1)[C@H]1CCC[C@]1(O)c1ccccc1.
What is the InChIKey of [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone?
The InChIKey is MZPWPYSHMFHRFW-RQSISSSHSA-N. The full InChI is InChI=1S/2C18H18O2/c2*19-17(14-8-3-1-4-9-14)16-12-7-13-18(16,20)15-10-5-2-6-11-15/h2*1-6,8-11,16,20H,7,12-13H2/t2*16-,18+/m11/s1.
What are the key properties of [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone?
[(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone has a molecular weight of 532.68 g/mol, XLogP of 7.11, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone is sourced from PubChem (CID 139093565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).