C13H24N4 — CID 139093630
2,4,5-trimethyl-N,N'-di(propan-2-yl)imidazole-1-carboximidamide (PubChem CID 139093630) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2,4,5-trimethyl-N,N'-di(propan-2-yl)imidazole-1-carboximidamide.
| Compound Name | 2,4,5-trimethyl-N,N'-di(propan-2-yl)imidazole-1-carboximidamide |
|---|---|
| PubChem CID | 139093630 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 2,4,5-trimethyl-N,N'-di(propan-2-yl)imidazole-1-carboximidamide |
| SMILES | Cc1nc(C)n(/C(=N\C(C)C)NC(C)C)c1C |
| InChI | InChI=1S/C13H24N4/c1-8(2)14-13(15-9(3)4)17-11(6)10(5)16-12(17)7/h8-9H,1-7H3,(H,14,15) |
| InChIKey | XIOAWYYBEPGRFZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|