C31H24N6O2S — CID 139093640
N-phenyl-7-[[2-(phenylcarbamoyl)-1H-indol-7-yl]carbamothioylamino]-1H-indole-2-carboxamide (PubChem CID 139093640) has the molecular formula C31H24N6O2S and a molecular weight of 544.64 g/mol. Its IUPAC name is N-phenyl-7-[[2-(phenylcarbamoyl)-1H-indol-7-yl]carbamothioylamino]-1H-indole-2-carboxamide.
| Compound Name | N-phenyl-7-[[2-(phenylcarbamoyl)-1H-indol-7-yl]carbamothioylamino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 139093640 |
| Molecular Formula | C31H24N6O2S |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | N-phenyl-7-[[2-(phenylcarbamoyl)-1H-indol-7-yl]carbamothioylamino]-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc2cccc(NC(=S)Nc3cccc4cc(C(=O)Nc5ccccc5)[nH]c34)c2[nH]1 |
| InChI | InChI=1S/C31H24N6O2S/c38-29(32-21-11-3-1-4-12-21)25-17-19-9-7-15-23(27(19)34-25)36-31(40)37-24-16-8-10-20-18-26(35-28(20)24)30(39)33-22-13-5-2-6-14-22/h1-18,34-35H,(H,32,38)(H,33,39)(H2,36,37,40) |
| InChIKey | JYXAHBLLDWCXPO-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|